Difference between revisions of "PWY-6863"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * common-name: ** 2-iminosuccinate * smiles: ** c(=o)([o-])cc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3713 CPD-3713] == * common-name: ** cytidine 2',3'-cyclic monophosphate * smiles: ** c(c2(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3713 CPD-3713] == |
* common-name: | * common-name: | ||
| − | ** 2- | + | ** cytidine 2',3'-cyclic monophosphate |
* smiles: | * smiles: | ||
| − | ** c(=o) | + | ** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nmpzcczxcomsdq-xvfcmesisa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 304.176 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12059]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2- | + | {{#set: common-name=cytidine 2',3'-cyclic monophosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nmpzcczxcomsdq-xvfcmesisa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=304.176}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-3713
- common-name:
- cytidine 2',3'-cyclic monophosphate
- smiles:
- c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o
- inchi-key:
- nmpzcczxcomsdq-xvfcmesisa-m
- molecular-weight:
- 304.176
