Difference between revisions of "PWY-6863"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3713 CPD-3713] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-oxoacyl-CoAs Long-Chain-oxoacyl-CoAs] ==
 * common-name:
-** cytidine 2',3'-cyclic monophosphate
+** a long-chain 3-oxoacyl-coa
-* smiles:
-** c(c2(c3(c(c(n1(c(n=c(c=c1)n)=o))o2)op(=o)([o-])o3)))o
-* inchi-key:
-** nmpzcczxcomsdq-xvfcmesisa-m
-* molecular-weight:
-** 304.176
 == Reaction(s) known to consume the compound ==
-* [[RXN-12059]]
+* [[1.1.1.211-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[1.1.1.211-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=cytidine 2',3'-cyclic monophosphate}}
+{{#set: common-name=a long-chain 3-oxoacyl-coa}}
-{{#set: inchi-key=inchikey=nmpzcczxcomsdq-xvfcmesisa-m}}
-{{#set: molecular-weight=304.176}}