Difference between revisions of "PWY-6876"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13401 CPD-13401] ==
+== Pathway PWY-6876 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** l-alanyl-l-histidine
+** isopropanol biosynthesis (engineered)
-* smiles:
+== Reaction(s) found ==
-** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-]
+* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
-* inchi-key:
+* [[PYRUFLAVREDUCT-RXN]]
-** xzwxfwbhyrflef-fsplstopsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneISOPROPANOL-DEHYDROGENASE-NADP+-RXN ISOPROPANOL-DEHYDROGENASE-NADP+-RXN]
-** 226.235
+* [NoneACETOACETYL-COA-HYDROLASE-RXN ACETOACETYL-COA-HYDROLASE-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneACETOACETATE-DECARBOXYLASE-RXN ACETOACETATE-DECARBOXYLASE-RXN]
-* [[RXN0-6978]]
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=isopropanol biosynthesis (engineered)}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=2}}
-{{#set: common-name=l-alanyl-l-histidine}}
+{{#set: completion rate=0.4}}
-{{#set: inchi-key=inchikey=xzwxfwbhyrflef-fsplstopsa-n}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=226.235}}