Difference between revisions of "PWY-6876"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13401 CPD-13401] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHOLESTEROL CHOLESTEROL] ==
 * common-name:
-** l-alanyl-l-histidine
+** cholesterol
 * smiles:
-** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-]
+** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 * inchi-key:
-** xzwxfwbhyrflef-fsplstopsa-n
+** hvywmomldimfja-dpaqbdifsa-n
 * molecular-weight:
-** 226.235
+** 386.66
 == Reaction(s) known to consume the compound ==
-* [[RXN0-6978]]
+* [[1.14.99.38-RXN]]
+* [[RXN-12127]]
+* [[RXN-12693]]
+* [[RXN-12701]]
+* [[RXN-17655]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-12693]]
+* [[RXN66-28]]
+* [[RXN66-323]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-alanyl-l-histidine}}
+{{#set: common-name=cholesterol}}
-{{#set: inchi-key=inchikey=xzwxfwbhyrflef-fsplstopsa-n}}
+{{#set: inchi-key=inchikey=hvywmomldimfja-dpaqbdifsa-n}}
-{{#set: molecular-weight=226.235}}
+{{#set: molecular-weight=386.66}}