Difference between revisions of "PWY-6883"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] == * common-name: ** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone * s...")
(Created page with "Category:pathway == Pathway PWY-6883 == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** pyruvate fermentation to butanol ii (engineered) == Reaction(s) found ==...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] ==
+
== Pathway PWY-6883 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
+
** pyruvate fermentation to butanol ii (engineered)
* smiles:
+
== Reaction(s) found ==
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1)
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
* inchi-key:
+
* [[RXN-11662]]
** aftbilpwmusgin-mycgwmctsa-n
+
* [[RXN-11667]]
* molecular-weight:
+
* [[RXN-12558]]
** 683.068
+
* [[RXN-161]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
* [[RXN-14177]]
+
* [NoneBUTANAL-DEHYDROGENASE-RXN BUTANAL-DEHYDROGENASE-RXN]
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-2|tax-2759}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=pyruvate fermentation to butanol ii (engineered)}}
{{#set: common-name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}}
+
{{#set: nb reaction found=5}}
{{#set: inchi-key=inchikey=aftbilpwmusgin-mycgwmctsa-n}}
+
{{#set: completion rate=0.83}}
{{#set: molecular-weight=683.068}}
+
{{#set: nb total reaction=6}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-6883

  • taxonomic-range:
    • tax-2759
    • tax-2
  • common-name:
    • pyruvate fermentation to butanol ii (engineered)

Reaction(s) found

Reaction(s) not found

  • [NoneBUTANAL-DEHYDROGENASE-RXN BUTANAL-DEHYDROGENASE-RXN]