Difference between revisions of "PWY-6883"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] == * common-name: ** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone * s...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] == * common-name: ** d-ribitol * smiles: ** c(o)c(o)c(o)c(o)co * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] ==
 
* common-name:
 
* common-name:
** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
+
** d-ribitol
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1)
+
** c(o)c(o)c(o)c(o)co
 
* inchi-key:
 
* inchi-key:
** aftbilpwmusgin-mycgwmctsa-n
+
** hebkchpvoiaqta-zxfhetkhsa-n
 
* molecular-weight:
 
* molecular-weight:
** 683.068
+
** 152.147
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14177]]
+
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}}
+
{{#set: common-name=d-ribitol}}
{{#set: inchi-key=inchikey=aftbilpwmusgin-mycgwmctsa-n}}
+
{{#set: inchi-key=inchikey=hebkchpvoiaqta-zxfhetkhsa-n}}
{{#set: molecular-weight=683.068}}
+
{{#set: molecular-weight=152.147}}

Revision as of 09:22, 27 August 2019

Metabolite RIBITOL

  • common-name:
    • d-ribitol
  • smiles:
    • c(o)c(o)c(o)c(o)co
  • inchi-key:
    • hebkchpvoiaqta-zxfhetkhsa-n
  • molecular-weight:
    • 152.147

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality