Difference between revisions of "PWY-6886"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18885 CPD-18885] == * smiles: ** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)[o-])c=1c4([c-](c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == * common-name: ** 4-deoxy-l-threo-hex-4-enopyranuronate * smiles: ** c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == |
| + | * common-name: | ||
| + | ** 4-deoxy-l-threo-hex-4-enopyranuronate | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c(c1(oc(c(c(c=1)o)o)o))([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** iakkjsvsfctlry-baktxgbysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 175.118 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16512]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12177]] | ||
| + | * [[RXN-12178]] | ||
| + | * [[RXN-12270]] | ||
| + | * [[RXN-16485]] | ||
| + | * [[RXN-16512]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-deoxy-l-threo-hex-4-enopyranuronate}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=iakkjsvsfctlry-baktxgbysa-m}} |
| + | {{#set: molecular-weight=175.118}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-13122
- common-name:
- 4-deoxy-l-threo-hex-4-enopyranuronate
- smiles:
- c(c1(oc(c(c(c=1)o)o)o))([o-])=o
- inchi-key:
- iakkjsvsfctlry-baktxgbysa-m
- molecular-weight:
- 175.118
