Difference between revisions of "PWY-6886"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == * common-name: ** 4-deoxy-l-threo-hex-4-enopyranuronate * smiles: ** c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] == * common-name: ** gibberellin a12 * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] ==
 
* common-name:
 
* common-name:
** 4-deoxy-l-threo-hex-4-enopyranuronate
+
** gibberellin a12
 
* smiles:
 
* smiles:
** c(c1(oc(c(c(c=1)o)o)o))([o-])=o
+
** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
 
* inchi-key:
 
* inchi-key:
** iakkjsvsfctlry-baktxgbysa-m
+
** ujfqjdaesqjxtg-ufuzvnnqsa-l
 
* molecular-weight:
 
* molecular-weight:
** 175.118
+
** 330.423
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16512]]
+
* [[RXN1F-162]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12177]]
+
* [[RXN1F-161]]
* [[RXN-12178]]
 
* [[RXN-12270]]
 
* [[RXN-16485]]
 
* [[RXN-16512]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-deoxy-l-threo-hex-4-enopyranuronate}}
+
{{#set: common-name=gibberellin a12}}
{{#set: inchi-key=inchikey=iakkjsvsfctlry-baktxgbysa-m}}
+
{{#set: inchi-key=inchikey=ujfqjdaesqjxtg-ufuzvnnqsa-l}}
{{#set: molecular-weight=175.118}}
+
{{#set: molecular-weight=330.423}}

Revision as of 09:22, 27 August 2019

Metabolite CPD1F-95

  • common-name:
    • gibberellin a12
  • smiles:
    • c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
  • inchi-key:
    • ujfqjdaesqjxtg-ufuzvnnqsa-l
  • molecular-weight:
    • 330.423

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality