Difference between revisions of "PWY-6893"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18762 CPD-18762] == * common-name: ** 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-...")
(Created page with "Category:pathway == Pathway PWY-6893 == * taxonomic-range: ** tax-2 * common-name: ** thiamine diphosphate biosynthesis ii (bacillus) == Reaction(s) found == * RXN-12610...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18762 CPD-18762] ==
+
== Pathway PWY-6893 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide
+
** thiamine diphosphate biosynthesis ii (bacillus)
* smiles:
+
== Reaction(s) found ==
** cc(c)=cccc(c)=cccc(c)=ccc2(o)(c(c1(c=cc=cc=1[n+](=c(c)2)[o-]))=o)
+
* [[RXN-12610]]
* inchi-key:
+
== Reaction(s) not found ==
** hzbjgdkeajeslm-yefhwucqsa-n
+
* [NoneTHI-P-KIN-RXN THI-P-KIN-RXN]
* molecular-weight:
+
{{#set: taxonomic-range=tax-2}}
** 395.541
+
{{#set: common-name=thiamine diphosphate biosynthesis ii (bacillus)}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-17334]]
+
{{#set: completion rate=0.5}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=2}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide}}
 
{{#set: inchi-key=inchikey=hzbjgdkeajeslm-yefhwucqsa-n}}
 
{{#set: molecular-weight=395.541}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY-6893

  • taxonomic-range:
    • tax-2
  • common-name:
    • thiamine diphosphate biosynthesis ii (bacillus)

Reaction(s) found

Reaction(s) not found

  • [NoneTHI-P-KIN-RXN THI-P-KIN-RXN]