Difference between revisions of "PWY-6897"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8081 CPD-8081] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phenols Phenols] ==
 * common-name:
-** 1-18:3-2-18:3-digalactosyldiacylglycerol
+** a phenol
-* smiles:
-** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
-* inchi-key:
-** kdyapqvyjxuqny-ncuixijtsa-n
-* molecular-weight:
-** 937.216
 == Reaction(s) known to consume the compound ==
+* [[ARYL-SULFOTRANSFERASE-RXN]]
+* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-8311]]
+* [[ARYLDIALKYLPHOSPHATASE-RXN]]
-* [[RXN-8314]]
+* [[ARYLESTERASE-RXN]]
+* [[ARYLSULFAT-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-18:3-2-18:3-digalactosyldiacylglycerol}}
+{{#set: common-name=a phenol}}
-{{#set: inchi-key=inchikey=kdyapqvyjxuqny-ncuixijtsa-n}}
-{{#set: molecular-weight=937.216}}