Difference between revisions of "PWY-6901"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Combined-With-Exogenous-DNA DNA-Combined-With-Exogenous-DNA] == * common-name: ** dna combi...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == * common-name: ** 3-oxododecanoyl-coa * smiles: ** cccccccccc(=o)cc(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Combined-With-Exogenous-DNA DNA-Combined-With-Exogenous-DNA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] ==
 
* common-name:
 
* common-name:
** dna combined with exogenous dna to form a recombinational junction
+
** 3-oxododecanoyl-coa
 +
* smiles:
 +
** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** hqanbzhvwidnqz-gmhmeamdsa-j
 +
* molecular-weight:
 +
** 959.791
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.22.4-RXN]]
+
* [[HACD5]]
 +
* [[HACD5h]]
 +
* [[HACD5m]]
 +
* [[RXN-14274]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[HACD5]]
 +
* [[HACD5h]]
 +
* [[HACD5m]]
 +
* [[RXN-14274]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dna combined with exogenous dna to form a recombinational junction}}
+
{{#set: common-name=3-oxododecanoyl-coa}}
 +
{{#set: inchi-key=inchikey=hqanbzhvwidnqz-gmhmeamdsa-j}}
 +
{{#set: molecular-weight=959.791}}

Revision as of 14:18, 26 August 2019

Metabolite CPD0-2105

  • common-name:
    • 3-oxododecanoyl-coa
  • smiles:
    • cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • hqanbzhvwidnqz-gmhmeamdsa-j
  • molecular-weight:
    • 959.791

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality