Difference between revisions of "PWY-6901"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDINE URIDINE] ==
 * common-name:
-** 3-oxododecanoyl-coa
+** uridine
 * smiles:
-** cccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 * inchi-key:
-** hqanbzhvwidnqz-gmhmeamdsa-j
+** drtqhjpvmgbucf-xvfcmesisa-n
 * molecular-weight:
-** 959.791
+** 244.204
 == Reaction(s) known to consume the compound ==
-* [[HACD5]]
+* [[AUPT]]
-* [[HACD5h]]
+* [[DATUP]]
-* [[HACD5m]]
+* [[DCTUP]]
-* [[RXN-14274]]
+* [[DGTUP]]
+* [[DTTUP]]
+* [[DUTUP]]
+* [[GTUP]]
+* [[ITUP]]
+* [[URIDINE-NUCLEOSIDASE-RXN]]
+* [[URIDINEKIN-RXN]]
+* [[URKI-RXN]]
+* [[URPHOS-RXN]]
+* [[UTUP]]
 == Reaction(s) known to produce the compound ==
-* [[HACD5]]
+* [[CYTIDEAM2-RXN]]
-* [[HACD5h]]
+* [[RXN-14025]]
-* [[HACD5m]]
+* [[UMPP]]
-* [[RXN-14274]]
+* [[URPHOS-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-oxododecanoyl-coa}}
+{{#set: common-name=uridine}}
-{{#set: inchi-key=inchikey=hqanbzhvwidnqz-gmhmeamdsa-j}}
+{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
-{{#set: molecular-weight=959.791}}
+{{#set: molecular-weight=244.204}}