Difference between revisions of "PWY-6901"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDINE URIDINE] ==
+== Pathway PWY-5785 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** uridine
+** di-trans,poly-cis-undecaprenyl phosphate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
+* [[RXN-8999]]
-* inchi-key:
+== Reaction(s) not found ==
-** drtqhjpvmgbucf-xvfcmesisa-n
+* [NoneUNDECAPRENYL-DIPHOSPHATASE-RXN UNDECAPRENYL-DIPHOSPHATASE-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2}}
-** 244.204
+{{#set: common-name=di-trans,poly-cis-undecaprenyl phosphate biosynthesis}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[AUPT]]
+{{#set: completion rate=0.5}}
-* [[DATUP]]
+{{#set: nb total reaction=2}}
-* [[DCTUP]]
-* [[DGTUP]]
-* [[DTTUP]]
-* [[DUTUP]]
-* [[GTUP]]
-* [[ITUP]]
-* [[URIDINE-NUCLEOSIDASE-RXN]]
-* [[URIDINEKIN-RXN]]
-* [[URKI-RXN]]
-* [[URPHOS-RXN]]
-* [[UTUP]]
-== Reaction(s) known to produce the compound ==
-* [[CYTIDEAM2-RXN]]
-* [[RXN-14025]]
-* [[UMPP]]
-* [[URPHOS-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=uridine}}
-{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
-{{#set: molecular-weight=244.204}}