Difference between revisions of "PWY-6902"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] ==
+== Pathway PWY-6902 ==
+* taxonomic-range:
+** tax-33090
+** tax-33154
+** tax-1239
+** tax-201174
+** tax-976
+** tax-1224
 * common-name:
-** 1-deoxy-d-xylulose 5-phosphate
+** chitin degradation ii (vibrio)
-* smiles:
+== Reaction(s) found ==
-** cc(=o)c(o)c(o)cop([o-])(=o)[o-]
+* [[3.2.1.14-RXN]]
-* inchi-key:
+* [[RXN-12623]]
-** ajpadpzsrrughi-rfzpgflssa-l
+* [[RXN-12625]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 212.096
+* [NoneTRANS-RXN-323 TRANS-RXN-323]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12626 RXN-12626]
-* [[DXPREDISOM-RXN]]
+{{#set: taxonomic-range=tax-976|tax-201174|tax-33154|tax-33090|tax-1239|tax-1224}}
-* [[THIAZOLSYN2-RXN]]
+{{#set: common-name=chitin degradation ii (vibrio)}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=3}}
-* [[DXPREDISOM-RXN]]
+{{#set: completion rate=0.6}}
-* [[DXS-RXN]]
+{{#set: nb total reaction=5}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=1-deoxy-d-xylulose 5-phosphate}}
-{{#set: inchi-key=inchikey=ajpadpzsrrughi-rfzpgflssa-l}}
-{{#set: molecular-weight=212.096}}