Difference between revisions of "PWY-6910"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] == * common-name: ** l-leucine * smiles: ** cc(cc([n+])c([o-])=o)c * inchi-key: ** roh...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9865 CPD-9865] == * common-name: ** 6-(all-trans-decaprenyl)-2-methoxy-phenol * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9865 CPD-9865] ==
 
* common-name:
 
* common-name:
** l-leucine
+
** 6-(all-trans-decaprenyl)-2-methoxy-phenol
 
* smiles:
 
* smiles:
** cc(cc([n+])c([o-])=o)c
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** rohfnlrqfuqhch-yfkpbyrvsa-n
+
** fyllwsgfaaqkhu-gbbrockzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 131.174
+
** 805.321
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 
* [[LEUCINE--TRNA-LIGASE-RXN]]
 
* [[RXN-16293]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
+
* [[RXN-9233]]
* [[RXN0-6979]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-leucine}}
+
{{#set: common-name=6-(all-trans-decaprenyl)-2-methoxy-phenol}}
{{#set: inchi-key=inchikey=rohfnlrqfuqhch-yfkpbyrvsa-n}}
+
{{#set: inchi-key=inchikey=fyllwsgfaaqkhu-gbbrockzsa-n}}
{{#set: molecular-weight=131.174}}
+
{{#set: molecular-weight=805.321}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-9865

  • common-name:
    • 6-(all-trans-decaprenyl)-2-methoxy-phenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c)c
  • inchi-key:
    • fyllwsgfaaqkhu-gbbrockzsa-n
  • molecular-weight:
    • 805.321

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality