Difference between revisions of "PWY-6910"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9865 CPD-9865] == * common-name: ** 6-(all-trans-decaprenyl)-2-methoxy-phenol * smiles: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] == * common-name: ** deacetylmycothiol * smiles: ** c(o)c2(c(c(c(nc(=o)c([...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] == |
* common-name: | * common-name: | ||
| − | ** | + | ** deacetylmycothiol |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zgxscmbzzvxwgf-bseffjthsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 445.461 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1G-121]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=deacetylmycothiol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zgxscmbzzvxwgf-bseffjthsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=445.461}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD1G-120
- common-name:
- deacetylmycothiol
- smiles:
- c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
- inchi-key:
- zgxscmbzzvxwgf-bseffjthsa-o
- molecular-weight:
- 445.461
