Difference between revisions of "PWY-6910"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] ==
+== Pathway PWY-7124 ==
+* taxonomic-range:
+** tax-4930
+** tax-2
 * common-name:
-** deacetylmycothiol
+** ethylene biosynthesis v (engineered)
-* smiles:
+== Reaction(s) found ==
-** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
+* [[2PGADEHYDRAT-RXN]]
-* inchi-key:
+* [[3PGAREARR-RXN]]
-** zgxscmbzzvxwgf-bseffjthsa-o
+* [[ACONITATEDEHYDR-RXN]]
-* molecular-weight:
+* [[ACONITATEHYDR-RXN]]
-** 445.461
+* [[CITSYN-RXN]]
-== Reaction(s) known to consume the compound ==
+* [[ISOCITDEH-RXN]]
-== Reaction(s) known to produce the compound ==
+* [[PEPCARBOX-RXN]]
-* [[RXN1G-121]]
+== Reaction(s) not found ==
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-12538 RXN-12538]
-{{#set: common-name=deacetylmycothiol}}
+{{#set: taxonomic-range=tax-2|tax-4930}}
-{{#set: inchi-key=inchikey=zgxscmbzzvxwgf-bseffjthsa-o}}
+{{#set: common-name=ethylene biosynthesis v (engineered)}}
-{{#set: molecular-weight=445.461}}
+{{#set: nb reaction found=7}}
+{{#set: completion rate=0.88}}
+{{#set: nb total reaction=8}}