Difference between revisions of "PWY-6917"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-61 CPD-61] == * common-name: ** (2r,3s)-2,3-dimethylmalate * smiles: ** cc(c(=o)[o-])c(c)(o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S2O3 S2O3] == * common-name: ** thiosulfate * smiles: ** o=s(=o)([o-])s * inchi-key: ** dhcdfwk...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-61 CPD-61] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S2O3 S2O3] ==
 
* common-name:
 
* common-name:
** (2r,3s)-2,3-dimethylmalate
+
** thiosulfate
 
* smiles:
 
* smiles:
** cc(c(=o)[o-])c(c)(o)c(=o)[o-]
+
** o=s(=o)([o-])s
 
* inchi-key:
 
* inchi-key:
** wtiiulqjlzehgz-cvyqjglwsa-l
+
** dhcdfwkwkrszhf-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 160.126
+
** 113.126
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[23-DIMETHYLMALATE-LYASE-RXN]]
+
* [[SULFOCYS-RXN]]
 +
* [[THIOSULFATE-SULFURTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[SULFOCYS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2r,3s)-2,3-dimethylmalate}}
+
{{#set: common-name=thiosulfate}}
{{#set: inchi-key=inchikey=wtiiulqjlzehgz-cvyqjglwsa-l}}
+
{{#set: inchi-key=inchikey=dhcdfwkwkrszhf-uhfffaoysa-m}}
{{#set: molecular-weight=160.126}}
+
{{#set: molecular-weight=113.126}}

Revision as of 09:22, 27 August 2019

Metabolite S2O3

  • common-name:
    • thiosulfate
  • smiles:
    • o=s(=o)([o-])s
  • inchi-key:
    • dhcdfwkwkrszhf-uhfffaoysa-m
  • molecular-weight:
    • 113.126

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality