Difference between revisions of "PWY-6920"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-PYROPHOSPHATE THIAMINE-PYROPHOSPHATE] ==
+== Pathway PWY-6920 ==
 * common-name:
-** thiamine diphosphate
+** 6-gingerol analog biosynthesis (engineered)
-* smiles:
+== Reaction(s) found ==
-** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
+* [[4-COUMARATE--COA-LIGASE-RXN]]
-* inchi-key:
+* [[R223-RXN]]
-** ayekofbpnlcajy-uhfffaoysa-l
+* [[RXN-12669]]
-* molecular-weight:
+* [[RXN-14275]]
-** 422.288
+* [[RXN-14276]]
-== Reaction(s) known to consume the compound ==
+== Reaction(s) not found ==
-* [[RXN-12583]]
+* [NoneRXN-12668 RXN-12668]
-* [[RXN-14037]]
+{{#set: common-name=6-gingerol analog biosynthesis (engineered)}}
-* [[RXN0-3542]]
+{{#set: nb reaction found=5}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.83}}
-* [[PDHam2hi]]
+{{#set: nb total reaction=6}}
-* [[PDHam2mi]]
-* [[RXN-12508]]
-* [[RXN-14037]]
-* [[RXN0-3542]]
-* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
-* [[THIAMIN-TRIPHOSPHATASE-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=thiamine diphosphate}}
-{{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}}
-{{#set: molecular-weight=422.288}}