Difference between revisions of "PWY-6922"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S] == * common-name: ** 4...")
 
(Created page with "Category:pathway == Pathway PWY-6922 == * taxonomic-range: ** tax-4751 ** tax-33208 ** tax-33090 * common-name: ** l-nδ-acetylornithine biosynthesis == Reaction(s) f...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S] ==
+
== Pathway PWY-6922 ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-33208
 +
** tax-33090
 
* common-name:
 
* common-name:
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate
+
** l-nδ-acetylornithine biosynthesis
* smiles:
+
== Reaction(s) found ==
** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
+
* [[ARGINASE-RXN]]
* inchi-key:
+
* [[GLUTKIN-RXN]]
** bujztfindcqrgp-ztvljyeesa-l
+
* [[GLUTSEMIALDEHYDROG-RXN]]
* molecular-weight:
+
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
** 457.362
+
* [[RXN-14903]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
* [[RXN-12177]]
+
* [NoneRXN-12667 RXN-12667]
== Reaction(s) known to produce the compound ==
+
* [NoneSPONTPRO-RXN SPONTPRO-RXN]
== Reaction(s) of unknown directionality ==
+
{{#set: taxonomic-range=tax-4751|tax-33208|tax-33090}}
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate}}
+
{{#set: common-name=l-nδ-acetylornithine biosynthesis}}
{{#set: inchi-key=inchikey=bujztfindcqrgp-ztvljyeesa-l}}
+
{{#set: nb reaction found=5}}
{{#set: molecular-weight=457.362}}
+
{{#set: completion rate=0.71}}
 +
{{#set: nb total reaction=7}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-6922

  • taxonomic-range:
    • tax-4751
    • tax-33208
    • tax-33090
  • common-name:
    • l-nδ-acetylornithine biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-12667 RXN-12667]
  • [NoneSPONTPRO-RXN SPONTPRO-RXN]