Difference between revisions of "PWY-6932"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NOREPINEPHRINE NOREPINEPHRINE] == * common-name: ** (r)-noradrenaline * smiles: ** c1(c=c(o)c(=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13930 CPD-13930] == * common-name: ** (z)-2-methyl-peroxyaminoacrylate * smiles: ** cc(=cn)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NOREPINEPHRINE NOREPINEPHRINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13930 CPD-13930] ==
 
* common-name:
 
* common-name:
** (r)-noradrenaline
+
** (z)-2-methyl-peroxyaminoacrylate
 
* smiles:
 
* smiles:
** c1(c=c(o)c(=cc=1c(c[n+])o)o)
+
** cc(=cn)c(=o)oo
 
* inchi-key:
 
* inchi-key:
** sflshlfxelfnjz-qmmmgpobsa-o
+
** dyysamfojrgamq-ihwypqmzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 170.188
+
** 117.104
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10907]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+
* [[RXN-12895]]
 +
* [[RXN-12896]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-noradrenaline}}
+
{{#set: common-name=(z)-2-methyl-peroxyaminoacrylate}}
{{#set: inchi-key=inchikey=sflshlfxelfnjz-qmmmgpobsa-o}}
+
{{#set: inchi-key=inchikey=dyysamfojrgamq-ihwypqmzsa-n}}
{{#set: molecular-weight=170.188}}
+
{{#set: molecular-weight=117.104}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-13930

  • common-name:
    • (z)-2-methyl-peroxyaminoacrylate
  • smiles:
    • cc(=cn)c(=o)oo
  • inchi-key:
    • dyysamfojrgamq-ihwypqmzsa-n
  • molecular-weight:
    • 117.104

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality