Difference between revisions of "PWY-6942"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] ==
+== Pathway PWY-6942 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** methyl parathion
+** dtdp-d-desosamine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cop(oc1(=cc=c(c=c1)[n+](=o)[o-]))(oc)=s
+* [[DTDPGLUCDEHYDRAT-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** rlbiqvvomopohc-uhfffaoysa-n
+* [None2.6.1.33-RXN 2.6.1.33-RXN]
-* molecular-weight:
+* [NoneRXN-12767 RXN-12767]
-** 263.204
+* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12768 RXN-12768]
-* [[RXN-8743]]
+* [NoneRXN-12769 RXN-12769]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=dtdp-d-desosamine biosynthesis}}
-{{#set: common-name=methyl parathion}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=rlbiqvvomopohc-uhfffaoysa-n}}
+{{#set: completion rate=0.17}}
-{{#set: molecular-weight=263.204}}
+{{#set: nb total reaction=6}}