Difference between revisions of "PWY-6942"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] == * common-name: ** 4-hydroxy-2-nonenal-[l-cys] conjugate * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** 4-hydroxy-2-nonenal-[l-cys] conjugate
+
** chlorophyllide a
* smiles:
 
** cccccc(o)c(cc=o)scc([n+])c(=o)[o-]
 
* inchi-key:
 
** salpdushmtyyoh-uhfffaoysa-n
 
 
* molecular-weight:
 
* molecular-weight:
** 277.378
+
** 612.967
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13398]]
 +
* [[RXN-7663]]
 +
* [[RXN-7676]]
 +
* [[RXN1F-66]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13677]]
+
* [[RXN-5286]]
 +
* [[RXN1F-10]]
 +
* [[RXN1F-66]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxy-2-nonenal-[l-cys] conjugate}}
+
{{#set: common-name=chlorophyllide a}}
{{#set: inchi-key=inchikey=salpdushmtyyoh-uhfffaoysa-n}}
+
{{#set: molecular-weight=612.967}}
{{#set: molecular-weight=277.378}}
 

Revision as of 09:22, 27 August 2019

Metabolite CHLOROPHYLLIDE-A

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • chlorophyllide a
  • molecular-weight:
    • 612.967

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality