Difference between revisions of "PWY-6945"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] == * common-name: ** 1,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)n...")
(Created page with "Category:pathway == Pathway PWY-6945 == * taxonomic-range: ** tax-2 * common-name: ** cholesterol degradation to androstenedione i (cholesterol oxidase) == Reaction(s) fou...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] ==
+
== Pathway PWY-6945 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 1,7-dimethylurate
+
** cholesterol degradation to androstenedione i (cholesterol oxidase)
* smiles:
+
== Reaction(s) found ==
** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2))
+
* [[RXN-12705]]
* inchi-key:
+
* [[RXN-12710]]
** nofnclgcujjpku-uhfffaoysa-n
+
* [[RXN-12848]]
* molecular-weight:
+
* [[RXN-12849]]
** 196.165
+
* [[RXN-12850]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-12707 RXN-12707]
* [[RXN-11520]]
+
* [NoneRXN-12778 RXN-12778]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-12745 RXN-12745]
{{#set: common-name=1,7-dimethylurate}}
+
* [NoneRXN-12702 RXN-12702]
{{#set: inchi-key=inchikey=nofnclgcujjpku-uhfffaoysa-n}}
+
* [NoneRXN-12706 RXN-12706]
{{#set: molecular-weight=196.165}}
+
* [NoneRXN-12694 RXN-12694]
 +
* [NoneRXN-12744 RXN-12744]
 +
* [NoneRXN-12743 RXN-12743]
 +
* [NoneRXN-12704 RXN-12704]
 +
* [NoneRXN-12709 RXN-12709]
 +
* [NoneRXN-12708 RXN-12708]
 +
* [NoneRXN-12703 RXN-12703]
 +
{{#set: taxonomic-range=tax-2}}
 +
{{#set: common-name=cholesterol degradation to androstenedione i (cholesterol oxidase)}}
 +
{{#set: nb reaction found=5}}
 +
{{#set: completion rate=0.29}}
 +
{{#set: nb total reaction=17}}

Latest revision as of 10:59, 18 March 2021

Pathway PWY-6945

  • taxonomic-range:
    • tax-2
  • common-name:
    • cholesterol degradation to androstenedione i (cholesterol oxidase)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-12707 RXN-12707]
  • [NoneRXN-12778 RXN-12778]
  • [NoneRXN-12745 RXN-12745]
  • [NoneRXN-12702 RXN-12702]
  • [NoneRXN-12706 RXN-12706]
  • [NoneRXN-12694 RXN-12694]
  • [NoneRXN-12744 RXN-12744]
  • [NoneRXN-12743 RXN-12743]
  • [NoneRXN-12704 RXN-12704]
  • [NoneRXN-12709 RXN-12709]
  • [NoneRXN-12708 RXN-12708]
  • [NoneRXN-12703 RXN-12703]