Difference between revisions of "PWY-6948"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11524 CPD-11524] == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexano...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12179 CPD-12179] == * common-name: ** methylmalonate semialdehyde == Reaction(s) known to c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11524 CPD-11524] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12179 CPD-12179] ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa
+
** methylmalonate semialdehyde
* smiles:
 
** ccc=ccc1(c(ccc(=o)1)cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
* inchi-key:
 
** adgirvmshggghu-azvxsvfwsa-j
 
* molecular-weight:
 
** 1025.85
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10700]]
+
* [[1.2.1.27-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10702]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxohexanoyl)-coa}}
+
{{#set: common-name=methylmalonate semialdehyde}}
{{#set: inchi-key=inchikey=adgirvmshggghu-azvxsvfwsa-j}}
 
{{#set: molecular-weight=1025.85}}
 

Revision as of 09:22, 27 August 2019

Metabolite CPD-12179

  • common-name:
    • methylmalonate semialdehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality