Difference between revisions of "PWY-6952"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=K-HEXANOYL-COA K-HEXANOYL-COA] ==
+== Pathway PWY-5653 ==
+* taxonomic-range:
+** tax-2759
+** tax-2
 * common-name:
-** 3-oxohexanoyl-coa
+** nad biosynthesis from 2-amino-3-carboxymuconate semialdehyde
-* smiles:
+== Reaction(s) found ==
-** cccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)=o
+* [[NAD-SYNTH-GLN-RXN]]
-* inchi-key:
+* [[NICONUCADENYLYLTRAN-RXN]]
-** nfoyyxqavvywkv-hdrqghtbsa-j
+* [[QUINOPRIBOTRANS-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 875.63
+* [NoneRXN-5721 RXN-5721]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2|tax-2759}}
-* [[HACD2h]]
+{{#set: common-name=nad biosynthesis from 2-amino-3-carboxymuconate semialdehyde}}
-* [[RXN-12570]]
+{{#set: nb reaction found=3}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.75}}
-* [[ACACT2h]]
+{{#set: nb total reaction=4}}
-* [[HACD2h]]
-* [[RXN-12565]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=3-oxohexanoyl-coa}}
-{{#set: inchi-key=inchikey=nfoyyxqavvywkv-hdrqghtbsa-j}}
-{{#set: molecular-weight=875.63}}