Difference between revisions of "PWY-6953"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15362 CPD-15362] == * common-name: ** (2e,11z)-icosa-2,11-dienoyl-coa * smiles: ** cccccccc...")
(Created page with "Category:pathway == Pathway PWY-6953 == * taxonomic-range: ** tax-2 * common-name: ** dtdp-3-acetamido-α-d-fucose biosynthesis == Reaction(s) found == * DTDPGLUCDE...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15362 CPD-15362] ==
+
== Pathway PWY-6953 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** (2e,11z)-icosa-2,11-dienoyl-coa
+
** dtdp-3-acetamido-α-d-fucose biosynthesis
* smiles:
+
== Reaction(s) found ==
** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[DTDPGLUCDEHYDRAT-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** laeceuxzoonxdy-nwgwhigpsa-j
+
* [NoneRXN-12839 RXN-12839]
* molecular-weight:
+
* [NoneRXN-12806 RXN-12806]
** 1053.99
+
* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-12811 RXN-12811]
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-2}}
* [[RXN-14485]]
+
{{#set: common-name=dtdp-3-acetamido-α-d-fucose biosynthesis}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=1}}
{{#set: common-name=(2e,11z)-icosa-2,11-dienoyl-coa}}
+
{{#set: completion rate=0.2}}
{{#set: inchi-key=inchikey=laeceuxzoonxdy-nwgwhigpsa-j}}
+
{{#set: nb total reaction=5}}
{{#set: molecular-weight=1053.99}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-6953

  • taxonomic-range:
    • tax-2
  • common-name:
    • dtdp-3-acetamido-α-d-fucose biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-12839 RXN-12839]
  • [NoneRXN-12806 RXN-12806]
  • [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
  • [NoneRXN-12811 RXN-12811]