Difference between revisions of "PWY-6953"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] ==
+== Pathway PWY-6953 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** (s)-3-hydroxydecanoyl-coa
+** dtdp-3-acetamido-&alpha;-d-fucose biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
+* [[DTDPGLUCDEHYDRAT-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** hivsmyzamunfkz-pnpvfpmqsa-j
+* [NoneRXN-12839 RXN-12839]
-* molecular-weight:
+* [NoneRXN-12806 RXN-12806]
-** 933.753
+* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12811 RXN-12811]
-* [[ECOAH4h]]
+{{#set: taxonomic-range=tax-2}}
-* [[HACD4h]]
+{{#set: common-name=dtdp-3-acetamido-&alpha;-d-fucose biosynthesis}}
-* [[RXN-12490]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.2}}
-* [[ECOAH4h]]
+{{#set: nb total reaction=5}}
-* [[HACD4h]]
-* [[RXN-13616]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-3-hydroxydecanoyl-coa}}
-{{#set: inchi-key=inchikey=hivsmyzamunfkz-pnpvfpmqsa-j}}
-{{#set: molecular-weight=933.753}}