Difference between revisions of "PWY-6964"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] == * common-name: ** gibberellin a51 * smiles: ** c=c1(c3(cc4(c1)(c([ch]5(c2(c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] == * common-name: ** γ-tocopherol * smiles: ** cc(c)cccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] == |
* common-name: | * common-name: | ||
| − | ** | + | ** γ-tocopherol |
* smiles: | * smiles: | ||
| − | ** c | + | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** quedxnhftdjviy-dqczwyhmsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 416.686 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=γ-tocopherol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=quedxnhftdjviy-dqczwyhmsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=416.686}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite GAMA-TOCOPHEROL
- common-name:
- γ-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
- inchi-key:
- quedxnhftdjviy-dqczwyhmsa-n
- molecular-weight:
- 416.686
