Difference between revisions of "PWY-6964"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] == * common-name: ** γ-tocopherol * smiles: ** cc(c)cccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] == * common-name: ** 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one * smiles: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] ==
 
* common-name:
 
* common-name:
** γ-tocopherol
+
** 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
+
** csccc(c([o-])=co)=o
 
* inchi-key:
 
* inchi-key:
** quedxnhftdjviy-dqczwyhmsa-n
+
** cilxjjlqptuuss-xqrvvysfsa-m
 
* molecular-weight:
 
* molecular-weight:
** 416.686
+
** 161.195
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
+
* [[R147-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-tocopherol}}
+
{{#set: common-name=1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one}}
{{#set: inchi-key=inchikey=quedxnhftdjviy-dqczwyhmsa-n}}
+
{{#set: inchi-key=inchikey=cilxjjlqptuuss-xqrvvysfsa-m}}
{{#set: molecular-weight=416.686}}
+
{{#set: molecular-weight=161.195}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-85

  • common-name:
    • 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
  • smiles:
    • csccc(c([o-])=co)=o
  • inchi-key:
    • cilxjjlqptuuss-xqrvvysfsa-m
  • molecular-weight:
    • 161.195

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality