Difference between revisions of "PWY-6969"
Jump to navigation
Jump to search
(Created page with "{{#ask: Category:reaction | ?common-name | ?ec-number | ?nb gene associated | ?nb pathway associated | ?nb reconstruction source | ?reconstruction category | ?reconstructi...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] == * common-name: ** n-acetyl-serotonin glucuronide * smiles: ** cc(=o)ncc...") |
||
| Line 1: | Line 1: | ||
| − | + | [[Category:metabolite]] | |
| − | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] == | |
| − | + | * common-name: | |
| − | + | ** n-acetyl-serotonin glucuronide | |
| − | + | * smiles: | |
| − | + | ** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23)) | |
| − | + | * inchi-key: | |
| − | + | ** drkqfnyksnwotc-rngzqalnsa-m | |
| − | + | * molecular-weight: | |
| − | }} | + | ** 393.372 |
| + | == Reaction(s) known to consume the compound == | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11060]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=n-acetyl-serotonin glucuronide}} | ||
| + | {{#set: inchi-key=inchikey=drkqfnyksnwotc-rngzqalnsa-m}} | ||
| + | {{#set: molecular-weight=393.372}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-12016
- common-name:
- n-acetyl-serotonin glucuronide
- smiles:
- cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23))
- inchi-key:
- drkqfnyksnwotc-rngzqalnsa-m
- molecular-weight:
- 393.372
