Difference between revisions of "PWY-6974"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] ==
+== Pathway PWY-6974 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 2'-deoxyuridine
+** dtdp-l-olivose biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
+* [[DTDPGLUCDEHYDRAT-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** mxhrcpnrjammim-shyzeuofsa-n
+* [NoneRXN-12943 RXN-12943]
-* molecular-weight:
+* [NoneRXN-12404 RXN-12404]
-** 228.204
+* [NoneRXN-16262 RXN-16262]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12928 RXN-12928]
-* [[URA-PHOSPH-RXN]]
+* [NoneRXN-12929 RXN-12929]
-== Reaction(s) known to produce the compound ==
+* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
-* [[CYTIDEAM-RXN]]
+{{#set: taxonomic-range=tax-2}}
-* [[RXN-14143]]
+{{#set: common-name=dtdp-l-olivose biosynthesis}}
-* [[URA-PHOSPH-RXN]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.14}}
-{{#set: common-name=2'-deoxyuridine}}
+{{#set: nb total reaction=7}}
-{{#set: inchi-key=inchikey=mxhrcpnrjammim-shyzeuofsa-n}}
-{{#set: molecular-weight=228.204}}