Difference between revisions of "PWY-6976"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14646 CPD-14646] ==
+== Pathway PWY-6976 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 9-cis-&beta;-carotene
+** dtdp-l-mycarose biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)c))c)c
+* [[DTDPGLUCDEHYDRAT-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** oenhqhleoonyie-bvzamqqesa-n
+* [NoneRXN-12404 RXN-12404]
-* molecular-weight:
+* [NoneRXN-12940 RXN-12940]
-** 536.882
+* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12941 RXN-12941]
-* [[RXN-13641]]
+* [NoneRXN-12935 RXN-12935]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-12942 RXN-12942]
-* [[RXN-13641]]
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=dtdp-l-mycarose biosynthesis}}
-{{#set: common-name=9-cis-&beta;-carotene}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=oenhqhleoonyie-bvzamqqesa-n}}
+{{#set: completion rate=0.14}}
-{{#set: molecular-weight=536.882}}
+{{#set: nb total reaction=7}}