Difference between revisions of "PWY-6978"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Palmitoyl-ACPs Palmitoyl-ACPs] == * common-name: ** a palmitoyl-[acp] == Reaction(s) known to c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11877 CPD-11877] == * common-name: ** metanephrine * smiles: ** c[n+]cc(o)c1(c=cc(o)=c(oc)c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11877 CPD-11877] == |
* common-name: | * common-name: | ||
| − | ** | + | ** metanephrine |
| + | * smiles: | ||
| + | ** c[n+]cc(o)c1(c=cc(o)=c(oc)c=1) | ||
| + | * inchi-key: | ||
| + | ** jwjctzkfygdabj-vifpvbqesa-o | ||
| + | * molecular-weight: | ||
| + | ** 198.241 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10913]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=metanephrine}} |
| + | {{#set: inchi-key=inchikey=jwjctzkfygdabj-vifpvbqesa-o}} | ||
| + | {{#set: molecular-weight=198.241}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-11877
- common-name:
- metanephrine
- smiles:
- c[n+]cc(o)c1(c=cc(o)=c(oc)c=1)
- inchi-key:
- jwjctzkfygdabj-vifpvbqesa-o
- molecular-weight:
- 198.241
