Difference between revisions of "PWY-6981"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
+== Pathway PWY-6981 ==
+* taxonomic-range:
+** tax-6447
+** tax-6231
+** tax-6073
+** tax-6040
+** tax-5758
+** tax-6656
+** tax-4751
 * common-name:
-** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+** chitin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
+* [[PGLUCISOM-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** oinneunvozhbox-kwbdajkesa-k
+* [NonePHOSPHOGLUCMUT-RXN PHOSPHOGLUCMUT-RXN]
-* molecular-weight:
+* [NoneCHITIN-SYNTHASE-RXN CHITIN-SYNTHASE-RXN]
-** 447.424
+{{#set: taxonomic-range=tax-6231|tax-6073|tax-4751|tax-6447|tax-6040|tax-5758|tax-6656}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=chitin biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN0-5180]]
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
-{{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}}
-{{#set: molecular-weight=447.424}}