Difference between revisions of "PWY-6982"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE-5-PHOSPHATE XANTHOSINE-5-PHOSPHATE] ==
+== Pathway PWY-6982 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** xmp
+** umbelliferone biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23)))
+* [[4-COUMARATE--COA-LIGASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** dctlyfzhfgencw-uuokfmhzsa-l
+* [NoneRXN-12963 RXN-12963]
-* molecular-weight:
+* [NoneRXN-12965 RXN-12965]
-** 362.192
+{{#set: taxonomic-range=tax-33090}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=umbelliferone biosynthesis}}
-* [[GMP-SYN-GLUT-RXN]]
+{{#set: nb reaction found=1}}
-* [[GMP-SYN-NH3-RXN]]
+{{#set: completion rate=0.33}}
-* [[IMP-DEHYDROG-RXN]]
+{{#set: nb total reaction=3}}
-* [[X5NT]]
-* [[XMPXAN-RXN]]
-* [[XPPRT]]
-== Reaction(s) known to produce the compound ==
-* [[IMP-DEHYDROG-RXN]]
-* [[NTPD]]
-* [[RXN0-1603]]
-* [[XPPRT]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=xmp}}
-{{#set: inchi-key=inchikey=dctlyfzhfgencw-uuokfmhzsa-l}}
-{{#set: molecular-weight=362.192}}