Difference between revisions of "PWY-6982"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8052 CPD-8052] == * common-name: ** 1d-chiro-inositol * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] == * common-name: ** (3e)-dec-3-enoyl-coa * smiles: ** ccccccc=ccc(=o)sccn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (3e)-dec-3-enoyl-coa |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cqgvnmqhzqjnii-zjzqahhtsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 915.738 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14803]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(3e)-dec-3-enoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cqgvnmqhzqjnii-zjzqahhtsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=915.738}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-15692
- common-name:
- (3e)-dec-3-enoyl-coa
- smiles:
- ccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- cqgvnmqhzqjnii-zjzqahhtsa-j
- molecular-weight:
- 915.738
