Difference between revisions of "PWY-6992"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19217 CPD-19217] ==
+== Pathway PWY-6992 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** s-(hydroxysulfenamide)-glutathione
+** 1,5-anhydrofructose degradation
-* smiles:
+== Reaction(s) found ==
-** c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+* [[MANNKIN-RXN]]
-* inchi-key:
+* [[MANNPISOM-RXN]]
-** zoiidzwlsvvtgq-wdskdsinsa-m
+* [[PGLUCISOM-RXN]]
-* molecular-weight:
+* [[RXN-13064]]
-** 337.327
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [None1.1.1.292-RXN 1.1.1.292-RXN]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2}}
-* [[RXN-17884]]
+{{#set: common-name=1,5-anhydrofructose degradation}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=4}}
-{{#set: common-name=s-(hydroxysulfenamide)-glutathione}}
+{{#set: completion rate=0.8}}
-{{#set: inchi-key=inchikey=zoiidzwlsvvtgq-wdskdsinsa-m}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=337.327}}