Difference between revisions of "PWY-6993"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-201 CPD-201] ==
+== Pathway PWY-6993 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 4-hydroxybenzoyl-coa
+** nicotine degradation ii (pyrrolidine pathway)
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+* [[SUCCSEMIALDDEHYDROG-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** ltvxpvbfjbtnij-tyhxjlicsa-j
+* [NoneRXN-13081 RXN-13081]
-* molecular-weight:
+* [NoneMALEATE-ISOMERASE-RXN MALEATE-ISOMERASE-RXN]
-** 883.61
+* [NoneRXN-13082 RXN-13082]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-13076 RXN-13076]
-== Reaction(s) known to produce the compound ==
+* [None1.13.11.9-RXN 1.13.11.9-RXN]
-* [[RXN-11246]]
+* [NoneRXN-11318 RXN-11318]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-13088 RXN-13088]
-{{#set: common-name=4-hydroxybenzoyl-coa}}
+* [NoneRXN-13089 RXN-13089]
-{{#set: inchi-key=inchikey=ltvxpvbfjbtnij-tyhxjlicsa-j}}
+* [NoneRXN-646 RXN-646]
-{{#set: molecular-weight=883.61}}
+* [NoneRXN-13077 RXN-13077]
+{{#set: taxonomic-range=tax-2}}
+{{#set: common-name=nicotine degradation ii (pyrrolidine pathway)}}
+{{#set: nb reaction found=1}}
+{{#set: completion rate=0.09}}
+{{#set: nb total reaction=11}}