Difference between revisions of "PWY-7003"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYLMURAMATE UDP-N-ACETYLMURAMATE] == * common-name: ** udp-n-acetyl-α-d-muramate...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-AMINO-LEVULINATE 5-AMINO-LEVULINATE] == * common-name: ** 5-aminolevulinate * smiles: ** c(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYLMURAMATE UDP-N-ACETYLMURAMATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-AMINO-LEVULINATE 5-AMINO-LEVULINATE] ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-muramate
+
** 5-aminolevulinate
 
* smiles:
 
* smiles:
** cc(c([o-])=o)oc3(c(o)c(co)oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(nc(c)=o)3)
+
** c(c(c[n+])=o)cc([o-])=o
 
* inchi-key:
 
* inchi-key:
** nqbrvzndbbmblj-mqtlhlsbsa-k
+
** zgxjtsgniosylo-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 676.397
+
** 131.131
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PORPHOBILSYNTH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
+
* [[GSAAMINOTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-muramate}}
+
{{#set: common-name=5-aminolevulinate}}
{{#set: inchi-key=inchikey=nqbrvzndbbmblj-mqtlhlsbsa-k}}
+
{{#set: inchi-key=inchikey=zgxjtsgniosylo-uhfffaoysa-n}}
{{#set: molecular-weight=676.397}}
+
{{#set: molecular-weight=131.131}}

Revision as of 14:19, 26 August 2019

Metabolite 5-AMINO-LEVULINATE

  • common-name:
    • 5-aminolevulinate
  • smiles:
    • c(c(c[n+])=o)cc([o-])=o
  • inchi-key:
    • zgxjtsgniosylo-uhfffaoysa-n
  • molecular-weight:
    • 131.131

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality