Difference between revisions of "PWY-7013"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] ==
+== Pathway PWY-7013 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 3-oxo-(9z)-octadecenoyl-coa
+** l-1,2-propanediol degradation
-* smiles:
+== Reaction(s) found ==
-** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[RXN-13198]]
-* inchi-key:
+== Reaction(s) not found ==
-** aveyykdekgjvbu-bpmmelmssa-j
+* [NonePROPANEDIOL-DEHYDRATASE-RXN PROPANEDIOL-DEHYDRATASE-RXN]
-* molecular-weight:
+* [NoneRXN-12736 RXN-12736]
-** 1041.936
+* [NonePTAALT-RXN PTAALT-RXN]
-== Reaction(s) known to consume the compound ==
+* [NonePROPKIN-RXN PROPKIN-RXN]
-* [[RXN-17778]]
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=l-1,2-propanediol degradation}}
-* [[RXN-17777]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.2}}
-{{#set: common-name=3-oxo-(9z)-octadecenoyl-coa}}
+{{#set: nb total reaction=5}}
-{{#set: inchi-key=inchikey=aveyykdekgjvbu-bpmmelmssa-j}}
-{{#set: molecular-weight=1041.936}}