Difference between revisions of "PWY-7013"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == * common-name: ** 3-oxo-(9z)-octadecenoyl-coa * smiles: ** ccccccccc=cc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * common-name: ** (s)-2-amino-6-oxohexanoate * smiles: ** [ch](=o)cccc([n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] ==
 
* common-name:
 
* common-name:
** 3-oxo-(9z)-octadecenoyl-coa
+
** (s)-2-amino-6-oxohexanoate
 
* smiles:
 
* smiles:
** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** [ch](=o)cccc([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** aveyykdekgjvbu-bpmmelmssa-j
+
** gfxytqpnnxgict-yfkpbyrvsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1041.936
+
** 145.158
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17778]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17777]]
+
* [[1.5.1.9-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(9z)-octadecenoyl-coa}}
+
{{#set: common-name=(s)-2-amino-6-oxohexanoate}}
{{#set: inchi-key=inchikey=aveyykdekgjvbu-bpmmelmssa-j}}
+
{{#set: inchi-key=inchikey=gfxytqpnnxgict-yfkpbyrvsa-n}}
{{#set: molecular-weight=1041.936}}
+
{{#set: molecular-weight=145.158}}

Revision as of 14:19, 26 August 2019

Metabolite ALLYSINE

  • common-name:
    • (s)-2-amino-6-oxohexanoate
  • smiles:
    • [ch](=o)cccc([n+])c(=o)[o-]
  • inchi-key:
    • gfxytqpnnxgict-yfkpbyrvsa-n
  • molecular-weight:
    • 145.158

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality