Difference between revisions of "PWY-7014"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == * common-name: ** 4-prenylphlorisovalerophenone * smiles: ** cc(=ccc1(=c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=POLYPEPTIDE POLYPEPTIDE] == * common-name: ** a polypeptide == Reaction(s) known to consume the...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=POLYPEPTIDE POLYPEPTIDE] ==
 
* common-name:
 
* common-name:
** 4-prenylphlorisovalerophenone
+
** a polypeptide
* smiles:
 
** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c
 
* inchi-key:
 
** lwlgkghhvbvdkb-uhfffaoysa-m
 
* molecular-weight:
 
** 277.339
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7810]]
+
* [[3.4.14.10-RXN]]
 +
* [[3.4.14.5-RXN]]
 +
* [[3.4.14.9-RXN]]
 +
* [[3.4.24.56-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7811]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-prenylphlorisovalerophenone}}
+
{{#set: common-name=a polypeptide}}
{{#set: inchi-key=inchikey=lwlgkghhvbvdkb-uhfffaoysa-m}}
 
{{#set: molecular-weight=277.339}}
 

Revision as of 14:18, 26 August 2019

Metabolite POLYPEPTIDE

  • common-name:
    • a polypeptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality