Difference between revisions of "PWY-7033"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MENADIOL MENADIOL] ==
+== Pathway PWY-7033 ==
+* taxonomic-range:
+** tax-4751
+** tax-33090
 * common-name:
-** menadiol
+** alkane biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2))
+* [[RXN-7904]]
-* inchi-key:
+== Reaction(s) not found ==
-** zjtlzydqjhkrmq-uhfffaoysa-n
+* [NoneRXN-13281 RXN-13281]
-* molecular-weight:
+* [NoneRXN-13273 RXN-13273]
-** 174.199
+{{#set: taxonomic-range=tax-4751|tax-33090}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=alkane biosynthesis ii}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[NADH-DEHYDROGENASE-QUINONE-RXN]]
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=menadiol}}
-{{#set: inchi-key=inchikey=zjtlzydqjhkrmq-uhfffaoysa-n}}
-{{#set: molecular-weight=174.199}}