Difference between revisions of "PWY-7036"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALDEHYDE CONIFERYL-ALDEHYDE] == * common-name: ** coniferaldehyde * smiles: ** coc1(=...")
 
(Created page with "Category:pathway == Pathway PWY-7036 == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** very long chain fatty acid biosynthesis ii == Reaction(s) found == * RX...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALDEHYDE CONIFERYL-ALDEHYDE] ==
+
== Pathway PWY-7036 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** coniferaldehyde
+
** very long chain fatty acid biosynthesis ii
* smiles:
+
== Reaction(s) found ==
** coc1(=cc(c=cc=o)=cc=c(o)1)
+
* [[RXN-13294]]
* inchi-key:
+
* [[RXN-13295]]
** dkzbbwmurdfhne-nscuhmnnsa-n
+
* [[RXN-13296]]
* molecular-weight:
+
* [[RXN-13297]]
** 178.187
+
* [[RXN-13298]]
== Reaction(s) known to consume the compound ==
+
* [[RXN-13299]]
== Reaction(s) known to produce the compound ==
+
* [[RXN-13300]]
* [[RXN-1106]]
+
* [[RXN-13301]]
== Reaction(s) of unknown directionality ==
+
* [[RXN-13302]]
{{#set: common-name=coniferaldehyde}}
+
* [[RXN-13303]]
{{#set: inchi-key=inchikey=dkzbbwmurdfhne-nscuhmnnsa-n}}
+
* [[RXN-13304]]
{{#set: molecular-weight=178.187}}
+
* [[RXN-13305]]
 +
* [[RXN-13307]]
 +
* [[RXN-13308]]
 +
== Reaction(s) not found ==
 +
* [NoneRXN-13306 RXN-13306]
 +
* [NoneRXN-13309 RXN-13309]
 +
{{#set: taxonomic-range=tax-2|tax-2759}}
 +
{{#set: common-name=very long chain fatty acid biosynthesis ii}}
 +
{{#set: nb reaction found=14}}
 +
{{#set: completion rate=0.88}}
 +
{{#set: nb total reaction=16}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-7036

  • taxonomic-range:
    • tax-2759
    • tax-2
  • common-name:
    • very long chain fatty acid biosynthesis ii

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-13306 RXN-13306]
  • [NoneRXN-13309 RXN-13309]