Difference between revisions of "PWY-7036"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALDEHYDE CONIFERYL-ALDEHYDE] == * common-name: ** coniferaldehyde * smiles: ** coc1(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8630 CPD-8630] == * common-name: ** a 5'-diphospho-purine-[mrna] == Reaction(s) known to co...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALDEHYDE CONIFERYL-ALDEHYDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8630 CPD-8630] ==
 
* common-name:
 
* common-name:
** coniferaldehyde
+
** a 5'-diphospho-purine-[mrna]
* smiles:
 
** coc1(=cc(c=cc=o)=cc=c(o)1)
 
* inchi-key:
 
** dkzbbwmurdfhne-nscuhmnnsa-n
 
* molecular-weight:
 
** 178.187
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
 +
* [[RXN-12826]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1106]]
+
* [[POLYNUCLEOTIDE-5-PHOSPHATASE-RXN]]
 +
* [[RXN-12826]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coniferaldehyde}}
+
{{#set: common-name=a 5'-diphospho-purine-[mrna]}}
{{#set: inchi-key=inchikey=dkzbbwmurdfhne-nscuhmnnsa-n}}
 
{{#set: molecular-weight=178.187}}
 

Revision as of 14:18, 26 August 2019

Metabolite CPD-8630

  • common-name:
    • a 5'-diphospho-purine-[mrna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5'-diphospho-purine-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.