Difference between revisions of "PWY-7044"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] ==
+== Pathway PWY-7044 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
+** 5-nitroanthranilate degradation
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1)
+* [[RXN-10445]]
-* inchi-key:
+== Reaction(s) not found ==
-** aftbilpwmusgin-mycgwmctsa-n
+* [NoneRXN-14254 RXN-14254]
-* molecular-weight:
+* [NoneMALEYLPYRUVATE-ISOMERASE-RXN MALEYLPYRUVATE-ISOMERASE-RXN]
-** 683.068
+* [NoneRXN-11730 RXN-11730]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-14253 RXN-14253]
-* [[RXN-14177]]
+* [NoneRXN-13371 RXN-13371]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=5-nitroanthranilate degradation}}
-{{#set: common-name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=aftbilpwmusgin-mycgwmctsa-n}}
+{{#set: completion rate=0.17}}
-{{#set: molecular-weight=683.068}}
+{{#set: nb total reaction=6}}