Difference between revisions of "PWY-7050"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10576 CPD-10576] == * common-name: ** 4-chlorosalicylate * smiles: ** c(c1(c=cc(cl)=cc=1o))...")
(Created page with "Category:pathway == Pathway PWY-8191 == == Reaction(s) found == * RXN-21829 * RXN-21830 * RXN-21831 * RXN-21833 * RXN-21834 * RXN-21835 * RXN-218...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10576 CPD-10576] ==
+
== Pathway PWY-8191 ==
* common-name:
+
== Reaction(s) found ==
** 4-chlorosalicylate
+
* [[RXN-21829]]
* smiles:
+
* [[RXN-21830]]
** c(c1(c=cc(cl)=cc=1o))([o-])=o
+
* [[RXN-21831]]
* inchi-key:
+
* [[RXN-21833]]
** lwxfczxrfbuoor-uhfffaoysa-m
+
* [[RXN-21834]]
* molecular-weight:
+
* [[RXN-21835]]
** 171.56
+
* [[RXN-21837]]
== Reaction(s) known to consume the compound ==
+
* [[RXN11876]]
* [[RXN-9912]]
+
* [[RXN11878]]
== Reaction(s) known to produce the compound ==
+
* [[RXN11884]]
== Reaction(s) of unknown directionality ==
+
* [[RXN21165]]
{{#set: common-name=4-chlorosalicylate}}
+
* [[RXN21166]]
{{#set: inchi-key=inchikey=lwxfczxrfbuoor-uhfffaoysa-m}}
+
* [[RXN21167]]
{{#set: molecular-weight=171.56}}
+
== Reaction(s) not found ==
 +
No padmetRef was given during wikipage creation or pathway not in metacyc, data not available
 +
{{#set: nb reaction found=13}}
 +
{{#set: completion rate=n.a}}
 +
{{#set: nb total reaction=n.a}}

Revision as of 20:18, 18 December 2020

Pathway PWY-8191

Reaction(s) found

Reaction(s) not found

No padmetRef was given during wikipage creation or pathway not in metacyc, data not available