Difference between revisions of "PWY-7066"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC GLC] == * common-name: ** β-d-glucopyranose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) *...") |
(Created page with "Category:pathway == Pathway PWY-4041 == * taxonomic-range: ** tax-33208 ** tax-4751 * common-name: ** γ-glutamyl cycle == Reaction(s) found == * 5-OXOPROLINASE-ATP...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:pathway]] |
| − | == | + | == Pathway PWY-4041 == |
| + | * taxonomic-range: | ||
| + | ** tax-33208 | ||
| + | ** tax-4751 | ||
* common-name: | * common-name: | ||
| − | ** & | + | ** γ-glutamyl cycle |
| − | + | == Reaction(s) found == | |
| − | + | * [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]] | |
| − | + | * [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]] | |
| − | + | * [[RXN-6601]] | |
| − | + | * [[RXN-6622]] | |
| − | + | == Reaction(s) not found == | |
| − | == Reaction(s) | + | All reactions of this pathways are in present |
| − | * [[ | + | {{#set: taxonomic-range=tax-4751|tax-33208}} |
| − | + | {{#set: common-name=γ-glutamyl cycle}} | |
| − | * [[ | + | {{#set: nb reaction found=4}} |
| − | + | {{#set: completion rate=1.0}} | |
| − | + | {{#set: nb total reaction=4}} | |
| − | |||
| − | * [[ | ||
| − | * [[ | ||
| − | == Reaction(s) of | ||
| − | {{#set: common-name=& | ||
| − | {{#set: | ||
| − | {{#set: | ||
Revision as of 20:18, 18 December 2020
Pathway PWY-4041
- taxonomic-range:
- tax-33208
- tax-4751
- common-name:
- γ-glutamyl cycle
Reaction(s) found
Reaction(s) not found
All reactions of this pathways are in present
