Difference between revisions of "PWY-7072"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13518 CPD-13518] == * common-name: ** nω-hydroxy-l-arginine * smiles: ** c(nc(no)=[n+...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14270 CPD-14270] == * common-name: ** dodecyl icosanoate * smiles: ** cccccccccccccccccccc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13518 CPD-13518] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14270 CPD-14270] ==
 
* common-name:
 
* common-name:
** nω-hydroxy-l-arginine
+
** dodecyl icosanoate
 
* smiles:
 
* smiles:
** c(nc(no)=[n+])ccc([n+])c([o-])=o
+
** cccccccccccccccccccc(occcccccccccc)=o
 
* inchi-key:
 
* inchi-key:
** fqwravymzulpnk-bypyzucnsa-o
+
** gffyhzlidinabp-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 191.209
+
** 480.856
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13565]]
+
* [[RXN-9356]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13564]]
+
* [[RXN-9356]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nω-hydroxy-l-arginine}}
+
{{#set: common-name=dodecyl icosanoate}}
{{#set: inchi-key=inchikey=fqwravymzulpnk-bypyzucnsa-o}}
+
{{#set: inchi-key=inchikey=gffyhzlidinabp-uhfffaoysa-n}}
{{#set: molecular-weight=191.209}}
+
{{#set: molecular-weight=480.856}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-14270

  • common-name:
    • dodecyl icosanoate
  • smiles:
    • cccccccccccccccccccc(occcccccccccc)=o
  • inchi-key:
    • gffyhzlidinabp-uhfffaoysa-n
  • molecular-weight:
    • 480.856

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality